C25H31NO4 — CID 69214750
1-[2-(1-adamantyl)-2-oxoethylidene]-6-methoxy-3,3-dimethyl-2,4-dihydroisoquinoline-7-carboxylic acid (PubChem CID 69214750) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is 1-[2-(1-adamantyl)-2-oxoethylidene]-6-methoxy-3,3-dimethyl-2,4-dihydroisoquinoline-7-carboxylic acid.
| Compound Name | 1-[2-(1-adamantyl)-2-oxoethylidene]-6-methoxy-3,3-dimethyl-2,4-dihydroisoquinoline-7-carboxylic acid |
|---|---|
| PubChem CID | 69214750 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 1-[2-(1-adamantyl)-2-oxoethylidene]-6-methoxy-3,3-dimethyl-2,4-dihydroisoquinoline-7-carboxylic acid |
| SMILES | COc1cc2c(cc1C(=O)O)C(=CC(=O)C13CC4CC(CC(C4)C1)C3)NC(C)(C)C2 |
| InChI | InChI=1S/C25H31NO4/c1-24(2)13-17-7-21(30-3)19(23(28)29)8-18(17)20(26-24)9-22(27)25-10-14-4-15(11-25)6-16(5-14)12-25/h7-9,14-16,26H,4-6,10-13H2,1-3H3,(H,28,29) |
| InChIKey | GJNCVTILBCEJOD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|