C24H30N2O3 — CID 69215148
1-(1-adamantyl)-2-(3,3,6-trimethyl-7-nitro-2,4-dihydroisoquinolin-1-ylidene)ethanone (PubChem CID 69215148) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is 1-(1-adamantyl)-2-(3,3,6-trimethyl-7-nitro-2,4-dihydroisoquinolin-1-ylidene)ethanone.
| Compound Name | 1-(1-adamantyl)-2-(3,3,6-trimethyl-7-nitro-2,4-dihydroisoquinolin-1-ylidene)ethanone |
|---|---|
| PubChem CID | 69215148 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 1-(1-adamantyl)-2-(3,3,6-trimethyl-7-nitro-2,4-dihydroisoquinolin-1-ylidene)ethanone |
| SMILES | Cc1cc2c(cc1[N+](=O)[O-])C(=CC(=O)C13CC4CC(CC(C4)C1)C3)NC(C)(C)C2 |
| InChI | InChI=1S/C24H30N2O3/c1-14-4-18-13-23(2,3)25-20(19(18)8-21(14)26(28)29)9-22(27)24-10-15-5-16(11-24)7-17(6-15)12-24/h4,8-9,15-17,25H,5-7,10-13H2,1-3H3 |
| InChIKey | FAEMBZKEMKUIAF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|