C20H21NO — CID 69215318
1-phenyl-2-(3,3,5-trimethyl-2,4-dihydroisoquinolin-1-ylidene)ethanone (PubChem CID 69215318) has the molecular formula C20H21NO and a molecular weight of 291.39 g/mol. Its IUPAC name is 1-phenyl-2-(3,3,5-trimethyl-2,4-dihydroisoquinolin-1-ylidene)ethanone.
| Compound Name | 1-phenyl-2-(3,3,5-trimethyl-2,4-dihydroisoquinolin-1-ylidene)ethanone |
|---|---|
| PubChem CID | 69215318 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 1-phenyl-2-(3,3,5-trimethyl-2,4-dihydroisoquinolin-1-ylidene)ethanone |
| SMILES | Cc1cccc2c1CC(C)(C)NC2=CC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H21NO/c1-14-8-7-11-16-17(14)13-20(2,3)21-18(16)12-19(22)15-9-5-4-6-10-15/h4-12,21H,13H2,1-3H3 |
| InChIKey | KKFSCRMYKUIWLU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|