About 1,1,1-trifluoropropan-2-yl cyclohexene-1-carboxylate
1,1,1-trifluoropropan-2-yl cyclohexene-1-carboxylate (PubChem CID 69215349) has the molecular formula C10H13F3O2
and a molecular weight of 222.21 g/mol. Its IUPAC name is 1,1,1-trifluoropropan-2-yl cyclohexene-1-carboxylate.
Molecular Properties
| Compound Name | 1,1,1-trifluoropropan-2-yl cyclohexene-1-carboxylate |
| PubChem CID | 69215349 |
| Molecular Formula | C10H13F3O2 |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 1,1,1-trifluoropropan-2-yl cyclohexene-1-carboxylate |
| SMILES | CC(OC(=O)C1=CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C10H13F3O2/c1-7(10(11,12)13)15-9(14)8-5-3-2-4-6-8/h5,7H,2-4,6H2,1H3 |
| InChIKey | MGTXNCZMUWNXGA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,1,1-trifluoropropan-2-yl cyclohexene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,1-trifluoropropan-2-yl cyclohexene-1-carboxylate?
The IUPAC name of 1,1,1-trifluoropropan-2-yl cyclohexene-1-carboxylate (CID 69215349) is 1,1,1-trifluoropropan-2-yl cyclohexene-1-carboxylate.
What is the SMILES notation for 1,1,1-trifluoropropan-2-yl cyclohexene-1-carboxylate?
The canonical SMILES for 1,1,1-trifluoropropan-2-yl cyclohexene-1-carboxylate is CC(OC(=O)C1=CCCCC1)C(F)(F)F.
What is the InChIKey of 1,1,1-trifluoropropan-2-yl cyclohexene-1-carboxylate?
The InChIKey is MGTXNCZMUWNXGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F3O2/c1-7(10(11,12)13)15-9(14)8-5-3-2-4-6-8/h5,7H,2-4,6H2,1H3.
What are the key properties of 1,1,1-trifluoropropan-2-yl cyclohexene-1-carboxylate?
1,1,1-trifluoropropan-2-yl cyclohexene-1-carboxylate has a molecular weight of 222.21 g/mol, XLogP of 2.98, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,1-trifluoropropan-2-yl cyclohexene-1-carboxylate is sourced from PubChem (CID 69215349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).