About 4-[2-(2-ethyl-5-methyl-1,3-thiazol-4-yl)ethenyl]-2-phenyl-1H-pyrazol-5-one;hydrochloride
4-[2-(2-ethyl-5-methyl-1,3-thiazol-4-yl)ethenyl]-2-phenyl-1H-pyrazol-5-one;hydrochloride (PubChem CID 69215468) has the molecular formula C17H18ClN3OS
and a molecular weight of 347.87 g/mol. Its IUPAC name is 4-[2-(2-ethyl-5-methyl-1,3-thiazol-4-yl)ethenyl]-2-phenyl-1H-pyrazol-5-one;hydrochloride.
Molecular Properties
| Compound Name | 4-[2-(2-ethyl-5-methyl-1,3-thiazol-4-yl)ethenyl]-2-phenyl-1H-pyrazol-5-one;hydrochloride |
| PubChem CID | 69215468 |
| Molecular Formula | C17H18ClN3OS |
| Molecular Weight | 347.87 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 4-[2-(2-ethyl-5-methyl-1,3-thiazol-4-yl)ethenyl]-2-phenyl-1H-pyrazol-5-one;hydrochloride |
| SMILES | CCc1nc(C=Cc2cn(-c3ccccc3)[nH]c2=O)c(C)s1.Cl |
| InChI | InChI=1S/C17H17N3OS.ClH/c1-3-16-18-15(12(2)22-16)10-9-13-11-20(19-17(13)21)14-7-5-4-6-8-14;/h4-11H,3H2,1-2H3,(H,19,21);1H |
| InChIKey | HKHDFUKLPAIGPW-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.87 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(2-ethyl-5-methyl-1,3-thiazol-4-yl)ethenyl]-2-phenyl-1H-pyrazol-5-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2-ethyl-5-methyl-1,3-thiazol-4-yl)ethenyl]-2-phenyl-1H-pyrazol-5-one;hydrochloride?
The IUPAC name of 4-[2-(2-ethyl-5-methyl-1,3-thiazol-4-yl)ethenyl]-2-phenyl-1H-pyrazol-5-one;hydrochloride (CID 69215468) is 4-[2-(2-ethyl-5-methyl-1,3-thiazol-4-yl)ethenyl]-2-phenyl-1H-pyrazol-5-one;hydrochloride.
What is the SMILES notation for 4-[2-(2-ethyl-5-methyl-1,3-thiazol-4-yl)ethenyl]-2-phenyl-1H-pyrazol-5-one;hydrochloride?
The canonical SMILES for 4-[2-(2-ethyl-5-methyl-1,3-thiazol-4-yl)ethenyl]-2-phenyl-1H-pyrazol-5-one;hydrochloride is CCc1nc(C=Cc2cn(-c3ccccc3)[nH]c2=O)c(C)s1.Cl.
What is the InChIKey of 4-[2-(2-ethyl-5-methyl-1,3-thiazol-4-yl)ethenyl]-2-phenyl-1H-pyrazol-5-one;hydrochloride?
The InChIKey is HKHDFUKLPAIGPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3OS.ClH/c1-3-16-18-15(12(2)22-16)10-9-13-11-20(19-17(13)21)14-7-5-4-6-8-14;/h4-11H,3H2,1-2H3,(H,19,21);1H.
What are the key properties of 4-[2-(2-ethyl-5-methyl-1,3-thiazol-4-yl)ethenyl]-2-phenyl-1H-pyrazol-5-one;hydrochloride?
4-[2-(2-ethyl-5-methyl-1,3-thiazol-4-yl)ethenyl]-2-phenyl-1H-pyrazol-5-one;hydrochloride has a molecular weight of 347.87 g/mol, XLogP of 4.09, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2-ethyl-5-methyl-1,3-thiazol-4-yl)ethenyl]-2-phenyl-1H-pyrazol-5-one;hydrochloride is sourced from PubChem (CID 69215468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).