C39H64O7Si2 — CID 69215476
methyl 4-[3-[3-[tert-butyl(dimethyl)silyl]oxy-2-[3-[tert-butyl(dimethyl)silyl]oxy-4-methyloct-1-en-6-ynyl]-5-oxocyclopentyl]-2-(methoxymethoxy)phenyl]butanoate (PubChem CID 69215476) has the molecular formula C39H64O7Si2 and a molecular weight of 701.11 g/mol. Its IUPAC name is methyl 4-[3-[3-[tert-butyl(dimethyl)silyl]oxy-2-[3-[tert-butyl(dimethyl)silyl]oxy-4-methyloct-1-en-6-ynyl]-5-oxocyclopentyl]-2-(methoxymethoxy)phenyl]butanoate.
| Compound Name | methyl 4-[3-[3-[tert-butyl(dimethyl)silyl]oxy-2-[3-[tert-butyl(dimethyl)silyl]oxy-4-methyloct-1-en-6-ynyl]-5-oxocyclopentyl]-2-(methoxymethoxy)phenyl]butanoate |
|---|---|
| PubChem CID | 69215476 |
| Molecular Formula | C39H64O7Si2 |
| Molecular Weight | 701.11 g/mol |
| Exact Mass | 700.42 |
| IUPAC Name | methyl 4-[3-[3-[tert-butyl(dimethyl)silyl]oxy-2-[3-[tert-butyl(dimethyl)silyl]oxy-4-methyloct-1-en-6-ynyl]-5-oxocyclopentyl]-2-(methoxymethoxy)phenyl]butanoate |
| SMILES | CC#CCC(C)C(C=CC1C(O[Si](C)(C)C(C)(C)C)CC(=O)C1c1cccc(CCCC(=O)OC)c1OCOC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C39H64O7Si2/c1-15-16-19-28(2)33(45-47(11,12)38(3,4)5)25-24-30-34(46-48(13,14)39(6,7)8)26-32(40)36(30)31-22-17-20-29(37(31)44-27-42-9)21-18-23-35(41)43-10/h17,20,22,24-25,28,30,33-34,36H,18-19,21,23,26-27H2,1-14H3 |
| InChIKey | LFYHXRULPLPZSC-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.11 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|