C8F4O4-2 — CID 6921563
3,4,5,6-tetrafluorophthalate (PubChem CID 6921563) has the molecular formula C8F4O4-2 and a molecular weight of 236.08 g/mol. Its IUPAC name is 3,4,5,6-tetrafluorophthalate.
| Compound Name | 3,4,5,6-tetrafluorophthalate |
|---|---|
| PubChem CID | 6921563 |
| Molecular Formula | C8F4O4-2 |
| Molecular Weight | 236.08 g/mol |
| Exact Mass | 235.97 |
| IUPAC Name | 3,4,5,6-tetrafluorophthalate |
| SMILES | O=C([O-])c1c(F)c(F)c(F)c(F)c1C(=O)[O-] |
| InChI | InChI=1S/C8H2F4O4/c9-3-1(7(13)14)2(8(15)16)4(10)6(12)5(3)11/h(H,13,14)(H,15,16)/p-2 |
| InChIKey | YJLVXRPNNDKMMO-UHFFFAOYSA-L |
| XLogP | -1.03 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.08 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|