C26H23ClF3N5O — CID 69216278
[5-chloro-6-[3-methyl-4-[5-phenyl-4-(3,4,5-trifluorophenyl)-1H-imidazol-2-yl]piperazin-1-yl]-3-pyridinyl]methanol (PubChem CID 69216278) has the molecular formula C26H23ClF3N5O and a molecular weight of 513.95 g/mol. Its IUPAC name is [5-chloro-6-[3-methyl-4-[5-phenyl-4-(3,4,5-trifluorophenyl)-1H-imidazol-2-yl]piperazin-1-yl]-3-pyridinyl]methanol.
| Compound Name | [5-chloro-6-[3-methyl-4-[5-phenyl-4-(3,4,5-trifluorophenyl)-1H-imidazol-2-yl]piperazin-1-yl]-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 69216278 |
| Molecular Formula | C26H23ClF3N5O |
| Molecular Weight | 513.95 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | [5-chloro-6-[3-methyl-4-[5-phenyl-4-(3,4,5-trifluorophenyl)-1H-imidazol-2-yl]piperazin-1-yl]-3-pyridinyl]methanol |
| SMILES | CC1CN(c2ncc(CO)cc2Cl)CCN1c1nc(-c2cc(F)c(F)c(F)c2)c(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C26H23ClF3N5O/c1-15-13-34(25-19(27)9-16(14-36)12-31-25)7-8-35(15)26-32-23(17-5-3-2-4-6-17)24(33-26)18-10-20(28)22(30)21(29)11-18/h2-6,9-12,15,36H,7-8,13-14H2,1H3,(H,32,33) |
| InChIKey | VBHHXWHEMBTITM-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.95 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|