C11H21N3O3Si — CID 69216651
N-[[dimethoxy(methyl)silyl]methyl]-2-propan-2-ylimidazole-1-carboxamide (PubChem CID 69216651) has the molecular formula C11H21N3O3Si and a molecular weight of 271.39 g/mol. Its IUPAC name is N-[[dimethoxy(methyl)silyl]methyl]-2-propan-2-ylimidazole-1-carboxamide.
| Compound Name | N-[[dimethoxy(methyl)silyl]methyl]-2-propan-2-ylimidazole-1-carboxamide |
|---|---|
| PubChem CID | 69216651 |
| Molecular Formula | C11H21N3O3Si |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | N-[[dimethoxy(methyl)silyl]methyl]-2-propan-2-ylimidazole-1-carboxamide |
| SMILES | CO[Si](C)(CNC(=O)n1ccnc1C(C)C)OC |
| InChI | InChI=1S/C11H21N3O3Si/c1-9(2)10-12-6-7-14(10)11(15)13-8-18(5,16-3)17-4/h6-7,9H,8H2,1-5H3,(H,13,15) |
| InChIKey | RKAPXZYPQBGQTK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|