About 2-butylbicyclo[2.2.1]hept-2-ene;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate
2-butylbicyclo[2.2.1]hept-2-ene;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate (PubChem CID 69217309) has the molecular formula C23H36O2
and a molecular weight of 344.54 g/mol. Its IUPAC name is 2-butylbicyclo[2.2.1]hept-2-ene;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate.
Molecular Properties
| Compound Name | 2-butylbicyclo[2.2.1]hept-2-ene;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate |
| PubChem CID | 69217309 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | 2-butylbicyclo[2.2.1]hept-2-ene;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate |
| SMILES | CCCCC1=CC2CCC1C2.CCCCOC(=O)C1=CC2CCC1C2 |
| InChI | InChI=1S/C12H18O2.C11H18/c1-2-3-6-14-12(13)11-8-9-4-5-10(11)7-9;1-2-3-4-10-7-9-5-6-11(10)8-9/h8-10H,2-7H2,1H3;7,9,11H,2-6,8H2,1H3 |
| InChIKey | ZCMDTOISQXOOPQ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-butylbicyclo[2.2.1]hept-2-ene;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylbicyclo[2.2.1]hept-2-ene;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate?
The IUPAC name of 2-butylbicyclo[2.2.1]hept-2-ene;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate (CID 69217309) is 2-butylbicyclo[2.2.1]hept-2-ene;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate.
What is the SMILES notation for 2-butylbicyclo[2.2.1]hept-2-ene;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate?
The canonical SMILES for 2-butylbicyclo[2.2.1]hept-2-ene;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate is CCCCC1=CC2CCC1C2.CCCCOC(=O)C1=CC2CCC1C2.
What is the InChIKey of 2-butylbicyclo[2.2.1]hept-2-ene;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate?
The InChIKey is ZCMDTOISQXOOPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2.C11H18/c1-2-3-6-14-12(13)11-8-9-4-5-10(11)7-9;1-2-3-4-10-7-9-5-6-11(10)8-9/h8-10H,2-7H2,1H3;7,9,11H,2-6,8H2,1H3.
What are the key properties of 2-butylbicyclo[2.2.1]hept-2-ene;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate?
2-butylbicyclo[2.2.1]hept-2-ene;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate has a molecular weight of 344.54 g/mol, XLogP of 6.22, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylbicyclo[2.2.1]hept-2-ene;butyl bicyclo[2.2.1]hept-2-ene-2-carboxylate is sourced from PubChem (CID 69217309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).