About 9-chloro-3-[(E)-2-pyridin-4-ylethenyl]-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one
9-chloro-3-[(E)-2-pyridin-4-ylethenyl]-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one (PubChem CID 69218688) has the molecular formula C20H14ClN3O
and a molecular weight of 347.81 g/mol. Its IUPAC name is 9-chloro-3-[(E)-2-pyridin-4-ylethenyl]-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one.
Molecular Properties
| Compound Name | 9-chloro-3-[(E)-2-pyridin-4-ylethenyl]-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
| PubChem CID | 69218688 |
| Molecular Formula | C20H14ClN3O |
| Molecular Weight | 347.81 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 9-chloro-3-[(E)-2-pyridin-4-ylethenyl]-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
| SMILES | O=C1Nc2cc(/C=C/c3ccncc3)ccc2Nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C20H14ClN3O/c21-15-4-5-16-18(12-15)23-17-6-3-14(11-19(17)24-20(16)25)2-1-13-7-9-22-10-8-13/h1-12,23H,(H,24,25)/b2-1+ |
| InChIKey | POIPTQKPSKIDAS-OWOJBTEDSA-N |
| XLogP | 5.21 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.81 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-chloro-3-[(E)-2-pyridin-4-ylethenyl]-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chloro-3-[(E)-2-pyridin-4-ylethenyl]-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one?
The IUPAC name of 9-chloro-3-[(E)-2-pyridin-4-ylethenyl]-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one (CID 69218688) is 9-chloro-3-[(E)-2-pyridin-4-ylethenyl]-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one.
What is the SMILES notation for 9-chloro-3-[(E)-2-pyridin-4-ylethenyl]-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one?
The canonical SMILES for 9-chloro-3-[(E)-2-pyridin-4-ylethenyl]-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one is O=C1Nc2cc(/C=C/c3ccncc3)ccc2Nc2cc(Cl)ccc21.
What is the InChIKey of 9-chloro-3-[(E)-2-pyridin-4-ylethenyl]-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one?
The InChIKey is POIPTQKPSKIDAS-OWOJBTEDSA-N. The full InChI is InChI=1S/C20H14ClN3O/c21-15-4-5-16-18(12-15)23-17-6-3-14(11-19(17)24-20(16)25)2-1-13-7-9-22-10-8-13/h1-12,23H,(H,24,25)/b2-1+.
What are the key properties of 9-chloro-3-[(E)-2-pyridin-4-ylethenyl]-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one?
9-chloro-3-[(E)-2-pyridin-4-ylethenyl]-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one has a molecular weight of 347.81 g/mol, XLogP of 5.21, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chloro-3-[(E)-2-pyridin-4-ylethenyl]-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one is sourced from PubChem (CID 69218688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).