C28H47N3O2 — CID 69218840
(2R,6S)-4-[3-(4,4-dimethylcyclohexyl)-4-[4-(2-ethoxyethyl)piperazin-1-yl]phenyl]-2,6-dimethylmorpholine (PubChem CID 69218840) has the molecular formula C28H47N3O2 and a molecular weight of 457.70 g/mol. Its IUPAC name is (2R,6S)-4-[3-(4,4-dimethylcyclohexyl)-4-[4-(2-ethoxyethyl)piperazin-1-yl]phenyl]-2,6-dimethylmorpholine.
| Compound Name | (2R,6S)-4-[3-(4,4-dimethylcyclohexyl)-4-[4-(2-ethoxyethyl)piperazin-1-yl]phenyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 69218840 |
| Molecular Formula | C28H47N3O2 |
| Molecular Weight | 457.70 g/mol |
| Exact Mass | 457.37 |
| IUPAC Name | (2R,6S)-4-[3-(4,4-dimethylcyclohexyl)-4-[4-(2-ethoxyethyl)piperazin-1-yl]phenyl]-2,6-dimethylmorpholine |
| SMILES | CCOCCN1CCN(c2ccc(N3C[C@@H](C)O[C@@H](C)C3)cc2C2CCC(C)(C)CC2)CC1 |
| InChI | InChI=1S/C28H47N3O2/c1-6-32-18-17-29-13-15-30(16-14-29)27-8-7-25(31-20-22(2)33-23(3)21-31)19-26(27)24-9-11-28(4,5)12-10-24/h7-8,19,22-24H,6,9-18,20-21H2,1-5H3/t22-,23+ |
| InChIKey | SXKUPTYKUKXNSW-ZRZAMGCNSA-N |
| XLogP | 5.14 |
| TPSA | 28.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.70 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|