About methyl 2-[4-(4-tert-butylcyclohexyl)-3-(4-butylpiperazin-1-yl)phenyl]acetate;hydrochloride
methyl 2-[4-(4-tert-butylcyclohexyl)-3-(4-butylpiperazin-1-yl)phenyl]acetate;hydrochloride (PubChem CID 69219040) has the molecular formula C27H45ClN2O2
and a molecular weight of 465.12 g/mol. Its IUPAC name is methyl 2-[4-(4-tert-butylcyclohexyl)-3-(4-butylpiperazin-1-yl)phenyl]acetate;hydrochloride.
Molecular Properties
| Compound Name | methyl 2-[4-(4-tert-butylcyclohexyl)-3-(4-butylpiperazin-1-yl)phenyl]acetate;hydrochloride |
| PubChem CID | 69219040 |
| Molecular Formula | C27H45ClN2O2 |
| Molecular Weight | 465.12 g/mol |
| Exact Mass | 464.32 |
| IUPAC Name | methyl 2-[4-(4-tert-butylcyclohexyl)-3-(4-butylpiperazin-1-yl)phenyl]acetate;hydrochloride |
| SMILES | CCCCN1CCN(c2cc(CC(=O)OC)ccc2C2CCC(C(C)(C)C)CC2)CC1.Cl |
| InChI | InChI=1S/C27H44N2O2.ClH/c1-6-7-14-28-15-17-29(18-16-28)25-19-21(20-26(30)31-5)8-13-24(25)22-9-11-23(12-10-22)27(2,3)4;/h8,13,19,22-23H,6-7,9-12,14-18,20H2,1-5H3;1H |
| InChIKey | QPWZQKHZDKSMMH-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.12 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[4-(4-tert-butylcyclohexyl)-3-(4-butylpiperazin-1-yl)phenyl]acetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[4-(4-tert-butylcyclohexyl)-3-(4-butylpiperazin-1-yl)phenyl]acetate;hydrochloride?
The IUPAC name of methyl 2-[4-(4-tert-butylcyclohexyl)-3-(4-butylpiperazin-1-yl)phenyl]acetate;hydrochloride (CID 69219040) is methyl 2-[4-(4-tert-butylcyclohexyl)-3-(4-butylpiperazin-1-yl)phenyl]acetate;hydrochloride.
What is the SMILES notation for methyl 2-[4-(4-tert-butylcyclohexyl)-3-(4-butylpiperazin-1-yl)phenyl]acetate;hydrochloride?
The canonical SMILES for methyl 2-[4-(4-tert-butylcyclohexyl)-3-(4-butylpiperazin-1-yl)phenyl]acetate;hydrochloride is CCCCN1CCN(c2cc(CC(=O)OC)ccc2C2CCC(C(C)(C)C)CC2)CC1.Cl.
What is the InChIKey of methyl 2-[4-(4-tert-butylcyclohexyl)-3-(4-butylpiperazin-1-yl)phenyl]acetate;hydrochloride?
The InChIKey is QPWZQKHZDKSMMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H44N2O2.ClH/c1-6-7-14-28-15-17-29(18-16-28)25-19-21(20-26(30)31-5)8-13-24(25)22-9-11-23(12-10-22)27(2,3)4;/h8,13,19,22-23H,6-7,9-12,14-18,20H2,1-5H3;1H.
What are the key properties of methyl 2-[4-(4-tert-butylcyclohexyl)-3-(4-butylpiperazin-1-yl)phenyl]acetate;hydrochloride?
methyl 2-[4-(4-tert-butylcyclohexyl)-3-(4-butylpiperazin-1-yl)phenyl]acetate;hydrochloride has a molecular weight of 465.12 g/mol, XLogP of 6.07, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[4-(4-tert-butylcyclohexyl)-3-(4-butylpiperazin-1-yl)phenyl]acetate;hydrochloride is sourced from PubChem (CID 69219040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).