C28H37N5O4Si — CID 69219378
2-[4-[tert-butyl(dimethyl)silyl]oxybutoxy]-3-methoxy-9-(pyrimidin-4-ylamino)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one (PubChem CID 69219378) has the molecular formula C28H37N5O4Si and a molecular weight of 535.72 g/mol. Its IUPAC name is 2-[4-[tert-butyl(dimethyl)silyl]oxybutoxy]-3-methoxy-9-(pyrimidin-4-ylamino)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 2-[4-[tert-butyl(dimethyl)silyl]oxybutoxy]-3-methoxy-9-(pyrimidin-4-ylamino)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 69219378 |
| Molecular Formula | C28H37N5O4Si |
| Molecular Weight | 535.72 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | 2-[4-[tert-butyl(dimethyl)silyl]oxybutoxy]-3-methoxy-9-(pyrimidin-4-ylamino)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
| SMILES | COc1cc2c(cc1OCCCCO[Si](C)(C)C(C)(C)C)Nc1cc(Nc3ccncn3)ccc1C(=O)N2 |
| InChI | InChI=1S/C28H37N5O4Si/c1-28(2,3)38(5,6)37-14-8-7-13-36-25-17-22-23(16-24(25)35-4)33-27(34)20-10-9-19(15-21(20)32-22)31-26-11-12-29-18-30-26/h9-12,15-18,32H,7-8,13-14H2,1-6H3,(H,33,34)(H,29,30,31) |
| InChIKey | UGCNEFNHGUEOTJ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 106.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.72 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|