About (1S)-3-prop-1-enoxy-1,2-dihydronaphthalen-1-ol
(1S)-3-prop-1-enoxy-1,2-dihydronaphthalen-1-ol (PubChem CID 69219656) has the molecular formula C13H14O2
and a molecular weight of 202.25 g/mol. Its IUPAC name is (1S)-3-prop-1-enoxy-1,2-dihydronaphthalen-1-ol.
Molecular Properties
| Compound Name | (1S)-3-prop-1-enoxy-1,2-dihydronaphthalen-1-ol |
| PubChem CID | 69219656 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (1S)-3-prop-1-enoxy-1,2-dihydronaphthalen-1-ol |
| SMILES | CC=COC1=Cc2ccccc2[C@@H](O)C1 |
| InChI | InChI=1S/C13H14O2/c1-2-7-15-11-8-10-5-3-4-6-12(10)13(14)9-11/h2-8,13-14H,9H2,1H3/t13-/m0/s1 |
| InChIKey | PKTHBWDZUDTYQA-ZDUSSCGKSA-N |
| XLogP | 3.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (1S)-3-prop-1-enoxy-1,2-dihydronaphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-3-prop-1-enoxy-1,2-dihydronaphthalen-1-ol?
The IUPAC name of (1S)-3-prop-1-enoxy-1,2-dihydronaphthalen-1-ol (CID 69219656) is (1S)-3-prop-1-enoxy-1,2-dihydronaphthalen-1-ol.
What is the SMILES notation for (1S)-3-prop-1-enoxy-1,2-dihydronaphthalen-1-ol?
The canonical SMILES for (1S)-3-prop-1-enoxy-1,2-dihydronaphthalen-1-ol is CC=COC1=Cc2ccccc2[C@@H](O)C1.
What is the InChIKey of (1S)-3-prop-1-enoxy-1,2-dihydronaphthalen-1-ol?
The InChIKey is PKTHBWDZUDTYQA-ZDUSSCGKSA-N. The full InChI is InChI=1S/C13H14O2/c1-2-7-15-11-8-10-5-3-4-6-12(10)13(14)9-11/h2-8,13-14H,9H2,1H3/t13-/m0/s1.
What are the key properties of (1S)-3-prop-1-enoxy-1,2-dihydronaphthalen-1-ol?
(1S)-3-prop-1-enoxy-1,2-dihydronaphthalen-1-ol has a molecular weight of 202.25 g/mol, XLogP of 3.01, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-3-prop-1-enoxy-1,2-dihydronaphthalen-1-ol is sourced from PubChem (CID 69219656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).