C30H34O18 — CID 69220629
bis[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] propanedioate;7-hydroxy-3-(4-hydroxyphenyl)chromen-4-one (PubChem CID 69220629) has the molecular formula C30H34O18 and a molecular weight of 682.58 g/mol. Its IUPAC name is bis[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] propanedioate;7-hydroxy-3-(4-hydroxyphenyl)chromen-4-one.
| Compound Name | bis[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] propanedioate;7-hydroxy-3-(4-hydroxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 69220629 |
| Molecular Formula | C30H34O18 |
| Molecular Weight | 682.58 g/mol |
| Exact Mass | 682.17 |
| IUPAC Name | bis[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] propanedioate;7-hydroxy-3-(4-hydroxyphenyl)chromen-4-one |
| SMILES | O=C(CC(=O)OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O.O=c1c(-c2ccc(O)cc2)coc2cc(O)ccc12 |
| InChI | InChI=1S/C15H24O14.C15H10O4/c16-2-4-8(20)10(22)12(24)14(26-4)28-6(18)1-7(19)29-15-13(25)11(23)9(21)5(3-17)27-15;16-10-3-1-9(2-4-10)13-8-19-14-7-11(17)5-6-12(14)15(13)18/h4-5,8-17,20-25H,1-3H2;1-8,16-17H/t4-,5-,8-,9-,10+,11+,12-,13-,14?,15?;/m1./s1 |
| InChIKey | GLGJIWZJPUEAHG-LVAWXZLNSA-N |
| XLogP | -3.07 |
| TPSA | 303.57 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.58 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|