C16H27NOSi — CID 69220700
tert-butyl-dimethyl-(2,3,4,5-tetrahydro-1H-1-benzazepin-5-yloxy)silane (PubChem CID 69220700) has the molecular formula C16H27NOSi and a molecular weight of 277.48 g/mol. Its IUPAC name is tert-butyl-dimethyl-(2,3,4,5-tetrahydro-1H-1-benzazepin-5-yloxy)silane.
| Compound Name | tert-butyl-dimethyl-(2,3,4,5-tetrahydro-1H-1-benzazepin-5-yloxy)silane |
|---|---|
| PubChem CID | 69220700 |
| Molecular Formula | C16H27NOSi |
| Molecular Weight | 277.48 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | tert-butyl-dimethyl-(2,3,4,5-tetrahydro-1H-1-benzazepin-5-yloxy)silane |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCCNc2ccccc21 |
| InChI | InChI=1S/C16H27NOSi/c1-16(2,3)19(4,5)18-15-11-8-12-17-14-10-7-6-9-13(14)15/h6-7,9-10,15,17H,8,11-12H2,1-5H3 |
| InChIKey | FVMGGHHYAMCBOF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|