C49H70N2O8 — CID 69221507
tert-butyl 2-[[1-[6-(2-ethoxyethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]-2-methylpropyl]carbamoyl]-4-pentylpyrrolidine-1-carboxylate (PubChem CID 69221507) has the molecular formula C49H70N2O8 and a molecular weight of 815.11 g/mol. Its IUPAC name is tert-butyl 2-[[1-[6-(2-ethoxyethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]-2-methylpropyl]carbamoyl]-4-pentylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[1-[6-(2-ethoxyethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]-2-methylpropyl]carbamoyl]-4-pentylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 69221507 |
| Molecular Formula | C49H70N2O8 |
| Molecular Weight | 815.11 g/mol |
| Exact Mass | 814.51 |
| IUPAC Name | tert-butyl 2-[[1-[6-(2-ethoxyethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]-2-methylpropyl]carbamoyl]-4-pentylpyrrolidine-1-carboxylate |
| SMILES | CCCCCC1CC(C(=O)NC(C(C)C)C2OC(CCOCC)C(OCc3ccccc3)C(OCc3ccccc3)C2OCc2ccccc2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C49H70N2O8/c1-8-10-14-27-39-30-40(51(31-39)48(53)59-49(5,6)7)47(52)50-42(35(3)4)44-46(57-34-38-25-19-13-20-26-38)45(56-33-37-23-17-12-18-24-37)43(41(58-44)28-29-54-9-2)55-32-36-21-15-11-16-22-36/h11-13,15-26,35,39-46H,8-10,14,27-34H2,1-7H3,(H,50,52) |
| InChIKey | QRTUBWSLHTYLCW-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.11 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|