C20H23N3O6 — CID 69221684
6-[2-(dimethylamino)ethylamino]-2-(3,4,5-trimethoxyphenyl)-1,3-benzoxazole-4,7-dione (PubChem CID 69221684) has the molecular formula C20H23N3O6 and a molecular weight of 401.42 g/mol. Its IUPAC name is 6-[2-(dimethylamino)ethylamino]-2-(3,4,5-trimethoxyphenyl)-1,3-benzoxazole-4,7-dione.
| Compound Name | 6-[2-(dimethylamino)ethylamino]-2-(3,4,5-trimethoxyphenyl)-1,3-benzoxazole-4,7-dione |
|---|---|
| PubChem CID | 69221684 |
| Molecular Formula | C20H23N3O6 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 6-[2-(dimethylamino)ethylamino]-2-(3,4,5-trimethoxyphenyl)-1,3-benzoxazole-4,7-dione |
| SMILES | COc1cc(-c2nc3c(o2)C(=O)C(NCCN(C)C)=CC3=O)cc(OC)c1OC |
| InChI | InChI=1S/C20H23N3O6/c1-23(2)7-6-21-12-10-13(24)16-19(17(12)25)29-20(22-16)11-8-14(26-3)18(28-5)15(9-11)27-4/h8-10,21H,6-7H2,1-5H3 |
| InChIKey | ULBHEDHPLUXSDQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 103.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|