C20H24FN3O — CID 69221896
N-[(7R,8R)-8-amino-7-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-N'-[2-(4-fluorophenyl)ethyl]ethanimidamide (PubChem CID 69221896) has the molecular formula C20H24FN3O and a molecular weight of 341.43 g/mol. Its IUPAC name is N-[(7R,8R)-8-amino-7-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-N'-[2-(4-fluorophenyl)ethyl]ethanimidamide.
| Compound Name | N-[(7R,8R)-8-amino-7-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-N'-[2-(4-fluorophenyl)ethyl]ethanimidamide |
|---|---|
| PubChem CID | 69221896 |
| Molecular Formula | C20H24FN3O |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | N-[(7R,8R)-8-amino-7-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-N'-[2-(4-fluorophenyl)ethyl]ethanimidamide |
| SMILES | C/C(=N\CCc1ccc(F)cc1)Nc1ccc2c(c1)[C@@H](N)[C@H](O)CC2 |
| InChI | InChI=1S/C20H24FN3O/c1-13(23-11-10-14-2-6-16(21)7-3-14)24-17-8-4-15-5-9-19(25)20(22)18(15)12-17/h2-4,6-8,12,19-20,25H,5,9-11,22H2,1H3,(H,23,24)/t19-,20-/m1/s1 |
| InChIKey | CUVHEHYVKCHXSY-WOJBJXKFSA-N |
| XLogP | 3.21 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|