C22H48O4Si3 — CID 69221980
trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyl-4-trimethylsilyloxycyclohexan-1-one (PubChem CID 69221980) has the molecular formula C22H48O4Si3 and a molecular weight of 460.88 g/mol. Its IUPAC name is trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyl-4-trimethylsilyloxycyclohexan-1-one.
| Compound Name | trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyl-4-trimethylsilyloxycyclohexan-1-one |
|---|---|
| PubChem CID | 69221980 |
| Molecular Formula | C22H48O4Si3 |
| Molecular Weight | 460.88 g/mol |
| Exact Mass | 460.29 |
| IUPAC Name | trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyl-4-trimethylsilyloxycyclohexan-1-one |
| SMILES | CC1(O[Si](C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)CC(=O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H48O4Si3/c1-20(2,3)28(11,12)24-18-15-17(23)16-19(22(18,7)26-27(8,9)10)25-29(13,14)21(4,5)6/h18-19H,15-16H2,1-14H3/t18-,19-/m1/s1 |
| InChIKey | VXXUJBTVZCCIBN-RTBURBONSA-N |
| XLogP | 6.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.88 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|