C17H26N2O4 — CID 69223117
1-O-tert-butyl 2-O-methyl 5-(3-cyanopropyl)-2,3,6,7-tetrahydroazepine-1,2-dicarboxylate (PubChem CID 69223117) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl 5-(3-cyanopropyl)-2,3,6,7-tetrahydroazepine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl 5-(3-cyanopropyl)-2,3,6,7-tetrahydroazepine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 69223117 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl 5-(3-cyanopropyl)-2,3,6,7-tetrahydroazepine-1,2-dicarboxylate |
| SMILES | COC(=O)C1CC=C(CCCC#N)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H26N2O4/c1-17(2,3)23-16(21)19-12-10-13(7-5-6-11-18)8-9-14(19)15(20)22-4/h8,14H,5-7,9-10,12H2,1-4H3 |
| InChIKey | BWZJQYIDUPXQMM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|