C12H16N2O — CID 6922341
(2R)-2,7,8-trimethyl-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one (PubChem CID 6922341) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is (2R)-2,7,8-trimethyl-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one.
| Compound Name | (2R)-2,7,8-trimethyl-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one |
|---|---|
| PubChem CID | 6922341 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | (2R)-2,7,8-trimethyl-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one |
| SMILES | Cc1cc2c(cc1C)N[C@H](C)CC(=O)N2 |
| InChI | InChI=1S/C12H16N2O/c1-7-4-10-11(5-8(7)2)14-12(15)6-9(3)13-10/h4-5,9,13H,6H2,1-3H3,(H,14,15)/t9-/m1/s1 |
| InChIKey | XLCUHBZBXLYRMW-SECBINFHSA-N |
| XLogP | 2.45 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |