About N,N-dimethyl-1-(2-pyridin-4-ylcyclohepten-1-yl)methanamine;hydrochloride
N,N-dimethyl-1-(2-pyridin-4-ylcyclohepten-1-yl)methanamine;hydrochloride (PubChem CID 69223601) has the molecular formula C15H23ClN2
and a molecular weight of 266.82 g/mol. Its IUPAC name is N,N-dimethyl-1-(2-pyridin-4-ylcyclohepten-1-yl)methanamine;hydrochloride.
Molecular Properties
| Compound Name | N,N-dimethyl-1-(2-pyridin-4-ylcyclohepten-1-yl)methanamine;hydrochloride |
| PubChem CID | 69223601 |
| Molecular Formula | C15H23ClN2 |
| Molecular Weight | 266.82 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | N,N-dimethyl-1-(2-pyridin-4-ylcyclohepten-1-yl)methanamine;hydrochloride |
| SMILES | CN(C)CC1=C(c2ccncc2)CCCCC1.Cl |
| InChI | InChI=1S/C15H22N2.ClH/c1-17(2)12-14-6-4-3-5-7-15(14)13-8-10-16-11-9-13;/h8-11H,3-7,12H2,1-2H3;1H |
| InChIKey | YHMVVKKPBBOCRX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.82 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dimethyl-1-(2-pyridin-4-ylcyclohepten-1-yl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-1-(2-pyridin-4-ylcyclohepten-1-yl)methanamine;hydrochloride?
The IUPAC name of N,N-dimethyl-1-(2-pyridin-4-ylcyclohepten-1-yl)methanamine;hydrochloride (CID 69223601) is N,N-dimethyl-1-(2-pyridin-4-ylcyclohepten-1-yl)methanamine;hydrochloride.
What is the SMILES notation for N,N-dimethyl-1-(2-pyridin-4-ylcyclohepten-1-yl)methanamine;hydrochloride?
The canonical SMILES for N,N-dimethyl-1-(2-pyridin-4-ylcyclohepten-1-yl)methanamine;hydrochloride is CN(C)CC1=C(c2ccncc2)CCCCC1.Cl.
What is the InChIKey of N,N-dimethyl-1-(2-pyridin-4-ylcyclohepten-1-yl)methanamine;hydrochloride?
The InChIKey is YHMVVKKPBBOCRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2.ClH/c1-17(2)12-14-6-4-3-5-7-15(14)13-8-10-16-11-9-13;/h8-11H,3-7,12H2,1-2H3;1H.
What are the key properties of N,N-dimethyl-1-(2-pyridin-4-ylcyclohepten-1-yl)methanamine;hydrochloride?
N,N-dimethyl-1-(2-pyridin-4-ylcyclohepten-1-yl)methanamine;hydrochloride has a molecular weight of 266.82 g/mol, XLogP of 3.78, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-1-(2-pyridin-4-ylcyclohepten-1-yl)methanamine;hydrochloride is sourced from PubChem (CID 69223601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).