C20H28N3O2+ — CID 6922361
[(1R,3R,6S,7R)-6,7-dimethyl-4-oxatricyclo[4.3.0.03,7]nonan-3-yl]-(4-pyridin-1-ium-2-ylpiperazin-1-yl)methanone (PubChem CID 6922361) has the molecular formula C20H28N3O2+ and a molecular weight of 342.46 g/mol. Its IUPAC name is [(1R,3R,6S,7R)-6,7-dimethyl-4-oxatricyclo[4.3.0.03,7]nonan-3-yl]-(4-pyridin-1-ium-2-ylpiperazin-1-yl)methanone.
| Compound Name | [(1R,3R,6S,7R)-6,7-dimethyl-4-oxatricyclo[4.3.0.03,7]nonan-3-yl]-(4-pyridin-1-ium-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 6922361 |
| Molecular Formula | C20H28N3O2+ |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | [(1R,3R,6S,7R)-6,7-dimethyl-4-oxatricyclo[4.3.0.03,7]nonan-3-yl]-(4-pyridin-1-ium-2-ylpiperazin-1-yl)methanone |
| SMILES | C[C@]12CC[C@@H]3C[C@@]1(C(=O)N1CCN(c4cccc[nH+]4)CC1)OC[C@@]32C |
| InChI | InChI=1S/C20H27N3O2/c1-18-14-25-20(13-15(18)6-7-19(18,20)2)17(24)23-11-9-22(10-12-23)16-5-3-4-8-21-16/h3-5,8,15H,6-7,9-14H2,1-2H3/p+1/t15-,18+,19-,20+/m1/s1 |
| InChIKey | TUCNDMSBQIUJQC-NMLACTOBSA-O |
| XLogP | 1.74 |
| TPSA | 46.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |