C19H32O6S — CID 69223691
(8R,9R,10R,13S,14S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol;sulfuric acid (PubChem CID 69223691) has the molecular formula C19H32O6S and a molecular weight of 388.53 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol;sulfuric acid.
| Compound Name | (8R,9R,10R,13S,14S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol;sulfuric acid |
|---|---|
| PubChem CID | 69223691 |
| Molecular Formula | C19H32O6S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | (8R,9R,10R,13S,14S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol;sulfuric acid |
| SMILES | C[C@]12CCC(O)CC1=CC[C@@H]1[C@H]2CC[C@]2(C)C(O)CC[C@@H]12.O=S(=O)(O)O |
| InChI | InChI=1S/C19H30O2.H2O4S/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18;1-5(2,3)4/h3,13-17,20-21H,4-11H2,1-2H3;(H2,1,2,3,4)/t13?,14-,15-,16+,17?,18-,19-;/m0./s1 |
| InChIKey | AASRKRDICOOIBN-GDQUTEOVSA-N |
| XLogP | 3.02 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|