C12H20S2 — CID 69223828
2-[(3S,5R)-3,5-dimethylcyclohexylidene]-1,3-dithiane (PubChem CID 69223828) has the molecular formula C12H20S2 and a molecular weight of 228.43 g/mol. Its IUPAC name is 2-[(3S,5R)-3,5-dimethylcyclohexylidene]-1,3-dithiane.
| Compound Name | 2-[(3S,5R)-3,5-dimethylcyclohexylidene]-1,3-dithiane |
|---|---|
| PubChem CID | 69223828 |
| Molecular Formula | C12H20S2 |
| Molecular Weight | 228.43 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2-[(3S,5R)-3,5-dimethylcyclohexylidene]-1,3-dithiane |
| SMILES | C[C@@H]1CC(=C2SCCCS2)C[C@H](C)C1 |
| InChI | InChI=1S/C12H20S2/c1-9-6-10(2)8-11(7-9)12-13-4-3-5-14-12/h9-10H,3-8H2,1-2H3/t9-,10+ |
| InChIKey | XGSBGIWWPFJVDR-AOOOYVTPSA-N |
| XLogP | 4.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |