C48H66N2O7 — CID 69223885
tert-butyl 2-[[2-methyl-1-[3,4,5-tris(phenylmethoxy)-6-prop-2-enyloxan-2-yl]propyl]carbamoyl]-4-pentylpyrrolidine-1-carboxylate (PubChem CID 69223885) has the molecular formula C48H66N2O7 and a molecular weight of 783.06 g/mol. Its IUPAC name is tert-butyl 2-[[2-methyl-1-[3,4,5-tris(phenylmethoxy)-6-prop-2-enyloxan-2-yl]propyl]carbamoyl]-4-pentylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[2-methyl-1-[3,4,5-tris(phenylmethoxy)-6-prop-2-enyloxan-2-yl]propyl]carbamoyl]-4-pentylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 69223885 |
| Molecular Formula | C48H66N2O7 |
| Molecular Weight | 783.06 g/mol |
| Exact Mass | 782.49 |
| IUPAC Name | tert-butyl 2-[[2-methyl-1-[3,4,5-tris(phenylmethoxy)-6-prop-2-enyloxan-2-yl]propyl]carbamoyl]-4-pentylpyrrolidine-1-carboxylate |
| SMILES | C=CCC1OC(C(NC(=O)C2CC(CCCCC)CN2C(=O)OC(C)(C)C)C(C)C)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C48H66N2O7/c1-8-10-14-28-38-29-39(50(30-38)47(52)57-48(5,6)7)46(51)49-41(34(3)4)43-45(55-33-37-26-19-13-20-27-37)44(54-32-36-24-17-12-18-25-36)42(40(56-43)21-9-2)53-31-35-22-15-11-16-23-35/h9,11-13,15-20,22-27,34,38-45H,2,8,10,14,21,28-33H2,1,3-7H3,(H,49,51) |
| InChIKey | RKLSNUOKVWTVEL-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.06 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|