C16H12BrF3N2O4S — CID 69224096
ethyl 5-bromo-3-[2-(trifluoromethyl)pyrrol-1-yl]sulfonyl-1H-indole-2-carboxylate (PubChem CID 69224096) has the molecular formula C16H12BrF3N2O4S and a molecular weight of 465.25 g/mol. Its IUPAC name is ethyl 5-bromo-3-[2-(trifluoromethyl)pyrrol-1-yl]sulfonyl-1H-indole-2-carboxylate.
| Compound Name | ethyl 5-bromo-3-[2-(trifluoromethyl)pyrrol-1-yl]sulfonyl-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 69224096 |
| Molecular Formula | C16H12BrF3N2O4S |
| Molecular Weight | 465.25 g/mol |
| Exact Mass | 463.97 |
| IUPAC Name | ethyl 5-bromo-3-[2-(trifluoromethyl)pyrrol-1-yl]sulfonyl-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccc(Br)cc2c1S(=O)(=O)n1cccc1C(F)(F)F |
| InChI | InChI=1S/C16H12BrF3N2O4S/c1-2-26-15(23)13-14(10-8-9(17)5-6-11(10)21-13)27(24,25)22-7-3-4-12(22)16(18,19)20/h3-8,21H,2H2,1H3 |
| InChIKey | XVGLUVWIWONMHV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.25 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |