About (2R,4S)-2-(4-fluorophenyl)-1,3-thiazolidin-3-ium-4-carboxylate
(2R,4S)-2-(4-fluorophenyl)-1,3-thiazolidin-3-ium-4-carboxylate (PubChem CID 6922415) has the molecular formula C10H10FNO2S
and a molecular weight of 227.26 g/mol. Its IUPAC name is (2R,4S)-2-(4-fluorophenyl)-1,3-thiazolidin-3-ium-4-carboxylate.
Molecular Properties
| Compound Name | (2R,4S)-2-(4-fluorophenyl)-1,3-thiazolidin-3-ium-4-carboxylate |
| PubChem CID | 6922415 |
| Molecular Formula | C10H10FNO2S |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | (2R,4S)-2-(4-fluorophenyl)-1,3-thiazolidin-3-ium-4-carboxylate |
| SMILES | O=C([O-])[C@H]1CS[C@H](c2ccc(F)cc2)[NH2+]1 |
| InChI | InChI=1S/C10H10FNO2S/c11-7-3-1-6(2-4-7)9-12-8(5-15-9)10(13)14/h1-4,8-9,12H,5H2,(H,13,14)/t8-,9-/m1/s1 |
| InChIKey | GPKWJQGAXZSDCF-RKDXNWHRSA-N |
| XLogP | -0.75 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,4S)-2-(4-fluorophenyl)-1,3-thiazolidin-3-ium-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4S)-2-(4-fluorophenyl)-1,3-thiazolidin-3-ium-4-carboxylate?
The IUPAC name of (2R,4S)-2-(4-fluorophenyl)-1,3-thiazolidin-3-ium-4-carboxylate (CID 6922415) is (2R,4S)-2-(4-fluorophenyl)-1,3-thiazolidin-3-ium-4-carboxylate.
What is the SMILES notation for (2R,4S)-2-(4-fluorophenyl)-1,3-thiazolidin-3-ium-4-carboxylate?
The canonical SMILES for (2R,4S)-2-(4-fluorophenyl)-1,3-thiazolidin-3-ium-4-carboxylate is O=C([O-])[C@H]1CS[C@H](c2ccc(F)cc2)[NH2+]1.
What is the InChIKey of (2R,4S)-2-(4-fluorophenyl)-1,3-thiazolidin-3-ium-4-carboxylate?
The InChIKey is GPKWJQGAXZSDCF-RKDXNWHRSA-N. The full InChI is InChI=1S/C10H10FNO2S/c11-7-3-1-6(2-4-7)9-12-8(5-15-9)10(13)14/h1-4,8-9,12H,5H2,(H,13,14)/t8-,9-/m1/s1.
What are the key properties of (2R,4S)-2-(4-fluorophenyl)-1,3-thiazolidin-3-ium-4-carboxylate?
(2R,4S)-2-(4-fluorophenyl)-1,3-thiazolidin-3-ium-4-carboxylate has a molecular weight of 227.26 g/mol, XLogP of -0.75, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4S)-2-(4-fluorophenyl)-1,3-thiazolidin-3-ium-4-carboxylate is sourced from PubChem (CID 6922415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).