About 4-[4-[1-(4-propan-2-ylsulfonylphenyl)propan-2-yl-propylamino]butyl]-1,4-diazepan-5-one
4-[4-[1-(4-propan-2-ylsulfonylphenyl)propan-2-yl-propylamino]butyl]-1,4-diazepan-5-one (PubChem CID 69224336) has the molecular formula C24H41N3O3S
and a molecular weight of 451.68 g/mol. Its IUPAC name is 4-[4-[1-(4-propan-2-ylsulfonylphenyl)propan-2-yl-propylamino]butyl]-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 4-[4-[1-(4-propan-2-ylsulfonylphenyl)propan-2-yl-propylamino]butyl]-1,4-diazepan-5-one |
| PubChem CID | 69224336 |
| Molecular Formula | C24H41N3O3S |
| Molecular Weight | 451.68 g/mol |
| Exact Mass | 451.29 |
| IUPAC Name | 4-[4-[1-(4-propan-2-ylsulfonylphenyl)propan-2-yl-propylamino]butyl]-1,4-diazepan-5-one |
| SMILES | CCCN(CCCCN1CCNCCC1=O)C(C)Cc1ccc(S(=O)(=O)C(C)C)cc1 |
| InChI | InChI=1S/C24H41N3O3S/c1-5-15-26(16-6-7-17-27-18-14-25-13-12-24(27)28)21(4)19-22-8-10-23(11-9-22)31(29,30)20(2)3/h8-11,20-21,25H,5-7,12-19H2,1-4H3 |
| InChIKey | BXNLGKQZIBTYFD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.68 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[1-(4-propan-2-ylsulfonylphenyl)propan-2-yl-propylamino]butyl]-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[1-(4-propan-2-ylsulfonylphenyl)propan-2-yl-propylamino]butyl]-1,4-diazepan-5-one?
The IUPAC name of 4-[4-[1-(4-propan-2-ylsulfonylphenyl)propan-2-yl-propylamino]butyl]-1,4-diazepan-5-one (CID 69224336) is 4-[4-[1-(4-propan-2-ylsulfonylphenyl)propan-2-yl-propylamino]butyl]-1,4-diazepan-5-one.
What is the SMILES notation for 4-[4-[1-(4-propan-2-ylsulfonylphenyl)propan-2-yl-propylamino]butyl]-1,4-diazepan-5-one?
The canonical SMILES for 4-[4-[1-(4-propan-2-ylsulfonylphenyl)propan-2-yl-propylamino]butyl]-1,4-diazepan-5-one is CCCN(CCCCN1CCNCCC1=O)C(C)Cc1ccc(S(=O)(=O)C(C)C)cc1.
What is the InChIKey of 4-[4-[1-(4-propan-2-ylsulfonylphenyl)propan-2-yl-propylamino]butyl]-1,4-diazepan-5-one?
The InChIKey is BXNLGKQZIBTYFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H41N3O3S/c1-5-15-26(16-6-7-17-27-18-14-25-13-12-24(27)28)21(4)19-22-8-10-23(11-9-22)31(29,30)20(2)3/h8-11,20-21,25H,5-7,12-19H2,1-4H3.
What are the key properties of 4-[4-[1-(4-propan-2-ylsulfonylphenyl)propan-2-yl-propylamino]butyl]-1,4-diazepan-5-one?
4-[4-[1-(4-propan-2-ylsulfonylphenyl)propan-2-yl-propylamino]butyl]-1,4-diazepan-5-one has a molecular weight of 451.68 g/mol, XLogP of 3.11, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[1-(4-propan-2-ylsulfonylphenyl)propan-2-yl-propylamino]butyl]-1,4-diazepan-5-one is sourced from PubChem (CID 69224336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).