C47H66N2O8 — CID 69224620
tert-butyl 2-[[1-[6-(2-hydroxyethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]-2-methylpropyl]carbamoyl]-4-pentylpyrrolidine-1-carboxylate (PubChem CID 69224620) has the molecular formula C47H66N2O8 and a molecular weight of 787.05 g/mol. Its IUPAC name is tert-butyl 2-[[1-[6-(2-hydroxyethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]-2-methylpropyl]carbamoyl]-4-pentylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[1-[6-(2-hydroxyethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]-2-methylpropyl]carbamoyl]-4-pentylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 69224620 |
| Molecular Formula | C47H66N2O8 |
| Molecular Weight | 787.05 g/mol |
| Exact Mass | 786.48 |
| IUPAC Name | tert-butyl 2-[[1-[6-(2-hydroxyethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]-2-methylpropyl]carbamoyl]-4-pentylpyrrolidine-1-carboxylate |
| SMILES | CCCCCC1CC(C(=O)NC(C(C)C)C2OC(CCO)C(OCc3ccccc3)C(OCc3ccccc3)C2OCc2ccccc2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C47H66N2O8/c1-7-8-12-25-37-28-38(49(29-37)46(52)57-47(4,5)6)45(51)48-40(33(2)3)42-44(55-32-36-23-17-11-18-24-36)43(54-31-35-21-15-10-16-22-35)41(39(56-42)26-27-50)53-30-34-19-13-9-14-20-34/h9-11,13-24,33,37-44,50H,7-8,12,25-32H2,1-6H3,(H,48,51) |
| InChIKey | OXFPPTCLTXCCIX-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.05 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|