C33H38O6 — CID 69224621
(3aR,4R,5S,6S,7R,7aS)-4,6,7-tris(phenylmethoxy)spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-ol (PubChem CID 69224621) has the molecular formula C33H38O6 and a molecular weight of 530.66 g/mol. Its IUPAC name is (3aR,4R,5S,6S,7R,7aS)-4,6,7-tris(phenylmethoxy)spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-ol.
| Compound Name | (3aR,4R,5S,6S,7R,7aS)-4,6,7-tris(phenylmethoxy)spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-ol |
|---|---|
| PubChem CID | 69224621 |
| Molecular Formula | C33H38O6 |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | (3aR,4R,5S,6S,7R,7aS)-4,6,7-tris(phenylmethoxy)spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-ol |
| SMILES | O[C@@H]1[C@@H](OCc2ccccc2)[C@H]2OC3(CCCCC3)O[C@H]2[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C33H38O6/c34-27-28(35-21-24-13-5-1-6-14-24)30(37-23-26-17-9-3-10-18-26)32-31(38-33(39-32)19-11-4-12-20-33)29(27)36-22-25-15-7-2-8-16-25/h1-3,5-10,13-18,27-32,34H,4,11-12,19-23H2/t27-,28-,29+,30+,31+,32-/m0/s1 |
| InChIKey | FGTCQPYPEHVAED-WTBLUJIGSA-N |
| XLogP | 5.56 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |