C19H21BrN2O7 — CID 69224820
(2R,3R,4S)-4-(5-bromo-2-hydroxyanilino)-2-(dimethoxymethyl)-2-methyl-6-nitro-3,4-dihydrochromen-3-ol (PubChem CID 69224820) has the molecular formula C19H21BrN2O7 and a molecular weight of 469.29 g/mol. Its IUPAC name is (2R,3R,4S)-4-(5-bromo-2-hydroxyanilino)-2-(dimethoxymethyl)-2-methyl-6-nitro-3,4-dihydrochromen-3-ol.
| Compound Name | (2R,3R,4S)-4-(5-bromo-2-hydroxyanilino)-2-(dimethoxymethyl)-2-methyl-6-nitro-3,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 69224820 |
| Molecular Formula | C19H21BrN2O7 |
| Molecular Weight | 469.29 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | (2R,3R,4S)-4-(5-bromo-2-hydroxyanilino)-2-(dimethoxymethyl)-2-methyl-6-nitro-3,4-dihydrochromen-3-ol |
| SMILES | COC(OC)[C@]1(C)Oc2ccc([N+](=O)[O-])cc2[C@H](Nc2cc(Br)ccc2O)[C@H]1O |
| InChI | InChI=1S/C19H21BrN2O7/c1-19(18(27-2)28-3)17(24)16(21-13-8-10(20)4-6-14(13)23)12-9-11(22(25)26)5-7-15(12)29-19/h4-9,16-18,21,23-24H,1-3H3/t16-,17+,19+/m0/s1 |
| InChIKey | YWSWYKGOEITSQX-YQVWRLOYSA-N |
| XLogP | 3.35 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|