About [(1R,5S)-8-(4-cyanonaphthalen-1-yl)-8-azabicyclo[3.2.1]octan-3-yl] 3-morpholin-4-ylpropanoate
[(1R,5S)-8-(4-cyanonaphthalen-1-yl)-8-azabicyclo[3.2.1]octan-3-yl] 3-morpholin-4-ylpropanoate (PubChem CID 69225104) has the molecular formula C25H29N3O3
and a molecular weight of 419.53 g/mol. Its IUPAC name is [(1R,5S)-8-(4-cyanonaphthalen-1-yl)-8-azabicyclo[3.2.1]octan-3-yl] 3-morpholin-4-ylpropanoate.
Molecular Properties
| Compound Name | [(1R,5S)-8-(4-cyanonaphthalen-1-yl)-8-azabicyclo[3.2.1]octan-3-yl] 3-morpholin-4-ylpropanoate |
| PubChem CID | 69225104 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | [(1R,5S)-8-(4-cyanonaphthalen-1-yl)-8-azabicyclo[3.2.1]octan-3-yl] 3-morpholin-4-ylpropanoate |
| SMILES | N#Cc1ccc(N2[C@@H]3CC[C@H]2CC(OC(=O)CCN2CCOCC2)C3)c2ccccc12 |
| InChI | InChI=1S/C25H29N3O3/c26-17-18-5-8-24(23-4-2-1-3-22(18)23)28-19-6-7-20(28)16-21(15-19)31-25(29)9-10-27-11-13-30-14-12-27/h1-5,8,19-21H,6-7,9-16H2/t19-,20+,21? |
| InChIKey | KGAWWAAVTRGXGT-WCRBZPEASA-N |
| XLogP | 3.48 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(1R,5S)-8-(4-cyanonaphthalen-1-yl)-8-azabicyclo[3.2.1]octan-3-yl] 3-morpholin-4-ylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,5S)-8-(4-cyanonaphthalen-1-yl)-8-azabicyclo[3.2.1]octan-3-yl] 3-morpholin-4-ylpropanoate?
The IUPAC name of [(1R,5S)-8-(4-cyanonaphthalen-1-yl)-8-azabicyclo[3.2.1]octan-3-yl] 3-morpholin-4-ylpropanoate (CID 69225104) is [(1R,5S)-8-(4-cyanonaphthalen-1-yl)-8-azabicyclo[3.2.1]octan-3-yl] 3-morpholin-4-ylpropanoate.
What is the SMILES notation for [(1R,5S)-8-(4-cyanonaphthalen-1-yl)-8-azabicyclo[3.2.1]octan-3-yl] 3-morpholin-4-ylpropanoate?
The canonical SMILES for [(1R,5S)-8-(4-cyanonaphthalen-1-yl)-8-azabicyclo[3.2.1]octan-3-yl] 3-morpholin-4-ylpropanoate is N#Cc1ccc(N2[C@@H]3CC[C@H]2CC(OC(=O)CCN2CCOCC2)C3)c2ccccc12.
What is the InChIKey of [(1R,5S)-8-(4-cyanonaphthalen-1-yl)-8-azabicyclo[3.2.1]octan-3-yl] 3-morpholin-4-ylpropanoate?
The InChIKey is KGAWWAAVTRGXGT-WCRBZPEASA-N. The full InChI is InChI=1S/C25H29N3O3/c26-17-18-5-8-24(23-4-2-1-3-22(18)23)28-19-6-7-20(28)16-21(15-19)31-25(29)9-10-27-11-13-30-14-12-27/h1-5,8,19-21H,6-7,9-16H2/t19-,20+,21?.
What are the key properties of [(1R,5S)-8-(4-cyanonaphthalen-1-yl)-8-azabicyclo[3.2.1]octan-3-yl] 3-morpholin-4-ylpropanoate?
[(1R,5S)-8-(4-cyanonaphthalen-1-yl)-8-azabicyclo[3.2.1]octan-3-yl] 3-morpholin-4-ylpropanoate has a molecular weight of 419.53 g/mol, XLogP of 3.48, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,5S)-8-(4-cyanonaphthalen-1-yl)-8-azabicyclo[3.2.1]octan-3-yl] 3-morpholin-4-ylpropanoate is sourced from PubChem (CID 69225104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).