C35H53NO2 — CID 69225403
3,5-bis[3-(4-tert-butylphenyl)butyl]-7a-ethyl-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazole (PubChem CID 69225403) has the molecular formula C35H53NO2 and a molecular weight of 519.81 g/mol. Its IUPAC name is 3,5-bis[3-(4-tert-butylphenyl)butyl]-7a-ethyl-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazole.
| Compound Name | 3,5-bis[3-(4-tert-butylphenyl)butyl]-7a-ethyl-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazole |
|---|---|
| PubChem CID | 69225403 |
| Molecular Formula | C35H53NO2 |
| Molecular Weight | 519.81 g/mol |
| Exact Mass | 519.41 |
| IUPAC Name | 3,5-bis[3-(4-tert-butylphenyl)butyl]-7a-ethyl-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazole |
| SMILES | CCC12COC(CCC(C)c3ccc(C(C)(C)C)cc3)N1C(CCC(C)c1ccc(C(C)(C)C)cc1)OC2 |
| InChI | InChI=1S/C35H53NO2/c1-10-35-23-37-31(21-11-25(2)27-13-17-29(18-14-27)33(4,5)6)36(35)32(38-24-35)22-12-26(3)28-15-19-30(20-16-28)34(7,8)9/h13-20,25-26,31-32H,10-12,21-24H2,1-9H3 |
| InChIKey | AGEDACWGEZSONU-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.81 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |