C22H24N4O2S — CID 69225761
2-[3-[2-(6,7-dimethyl-4-phenoxyimidazo[4,5-c]pyridin-1-yl)ethoxy]propyl]-1,3-thiazole (PubChem CID 69225761) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is 2-[3-[2-(6,7-dimethyl-4-phenoxyimidazo[4,5-c]pyridin-1-yl)ethoxy]propyl]-1,3-thiazole.
| Compound Name | 2-[3-[2-(6,7-dimethyl-4-phenoxyimidazo[4,5-c]pyridin-1-yl)ethoxy]propyl]-1,3-thiazole |
|---|---|
| PubChem CID | 69225761 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 2-[3-[2-(6,7-dimethyl-4-phenoxyimidazo[4,5-c]pyridin-1-yl)ethoxy]propyl]-1,3-thiazole |
| SMILES | Cc1nc(Oc2ccccc2)c2ncn(CCOCCCc3nccs3)c2c1C |
| InChI | InChI=1S/C22H24N4O2S/c1-16-17(2)25-22(28-18-7-4-3-5-8-18)20-21(16)26(15-24-20)11-13-27-12-6-9-19-23-10-14-29-19/h3-5,7-8,10,14-15H,6,9,11-13H2,1-2H3 |
| InChIKey | NZQDULJSRZAKJA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|