About 3-(3,5-dichlorophenyl)-4,5-dihydro-1,2-oxazole
3-(3,5-dichlorophenyl)-4,5-dihydro-1,2-oxazole (PubChem CID 69225817) has the molecular formula C9H7Cl2NO
and a molecular weight of 216.07 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-4,5-dihydro-1,2-oxazole.
Molecular Properties
| Compound Name | 3-(3,5-dichlorophenyl)-4,5-dihydro-1,2-oxazole |
| PubChem CID | 69225817 |
| Molecular Formula | C9H7Cl2NO |
| Molecular Weight | 216.07 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-4,5-dihydro-1,2-oxazole |
| SMILES | Clc1cc(Cl)cc(C2=NOCC2)c1 |
| InChI | InChI=1S/C9H7Cl2NO/c10-7-3-6(4-8(11)5-7)9-1-2-13-12-9/h3-5H,1-2H2 |
| InChIKey | WEPKQEBGWSWXGF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.07 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,5-dichlorophenyl)-4,5-dihydro-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dichlorophenyl)-4,5-dihydro-1,2-oxazole?
The IUPAC name of 3-(3,5-dichlorophenyl)-4,5-dihydro-1,2-oxazole (CID 69225817) is 3-(3,5-dichlorophenyl)-4,5-dihydro-1,2-oxazole.
What is the SMILES notation for 3-(3,5-dichlorophenyl)-4,5-dihydro-1,2-oxazole?
The canonical SMILES for 3-(3,5-dichlorophenyl)-4,5-dihydro-1,2-oxazole is Clc1cc(Cl)cc(C2=NOCC2)c1.
What is the InChIKey of 3-(3,5-dichlorophenyl)-4,5-dihydro-1,2-oxazole?
The InChIKey is WEPKQEBGWSWXGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7Cl2NO/c10-7-3-6(4-8(11)5-7)9-1-2-13-12-9/h3-5H,1-2H2.
What are the key properties of 3-(3,5-dichlorophenyl)-4,5-dihydro-1,2-oxazole?
3-(3,5-dichlorophenyl)-4,5-dihydro-1,2-oxazole has a molecular weight of 216.07 g/mol, XLogP of 3.12, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dichlorophenyl)-4,5-dihydro-1,2-oxazole is sourced from PubChem (CID 69225817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).