C42H34ClIN2O5S — CID 69225958
4-[2-[5-chloro-1-[iodo(diphenyl)methyl]-2-[2-(naphthalen-2-ylsulfonylamino)ethyl]indol-3-yl]ethoxy]benzoic acid (PubChem CID 69225958) has the molecular formula C42H34ClIN2O5S and a molecular weight of 841.17 g/mol. Its IUPAC name is 4-[2-[5-chloro-1-[iodo(diphenyl)methyl]-2-[2-(naphthalen-2-ylsulfonylamino)ethyl]indol-3-yl]ethoxy]benzoic acid.
| Compound Name | 4-[2-[5-chloro-1-[iodo(diphenyl)methyl]-2-[2-(naphthalen-2-ylsulfonylamino)ethyl]indol-3-yl]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 69225958 |
| Molecular Formula | C42H34ClIN2O5S |
| Molecular Weight | 841.17 g/mol |
| Exact Mass | 840.09 |
| IUPAC Name | 4-[2-[5-chloro-1-[iodo(diphenyl)methyl]-2-[2-(naphthalen-2-ylsulfonylamino)ethyl]indol-3-yl]ethoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OCCc2c(CCNS(=O)(=O)c3ccc4ccccc4c3)n(C(I)(c3ccccc3)c3ccccc3)c3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C42H34ClIN2O5S/c43-34-18-22-39-38(28-34)37(24-26-51-35-19-15-30(16-20-35)41(47)48)40(23-25-45-52(49,50)36-21-17-29-9-7-8-10-31(29)27-36)46(39)42(44,32-11-3-1-4-12-32)33-13-5-2-6-14-33/h1-22,27-28,45H,23-26H2,(H,47,48) |
| InChIKey | AIYRNFOTUNBNQP-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.17 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|