C24H18F4N6O2S — CID 69226367
N-[3-[4-fluoro-3-(trifluoromethyl)phenyl]-1,2,4-thiadiazol-5-yl]-4-[(2-propan-2-yloxy-4-pyridinyl)diazenyl]benzamide (PubChem CID 69226367) has the molecular formula C24H18F4N6O2S and a molecular weight of 530.51 g/mol. Its IUPAC name is N-[3-[4-fluoro-3-(trifluoromethyl)phenyl]-1,2,4-thiadiazol-5-yl]-4-[(2-propan-2-yloxy-4-pyridinyl)diazenyl]benzamide.
| Compound Name | N-[3-[4-fluoro-3-(trifluoromethyl)phenyl]-1,2,4-thiadiazol-5-yl]-4-[(2-propan-2-yloxy-4-pyridinyl)diazenyl]benzamide |
|---|---|
| PubChem CID | 69226367 |
| Molecular Formula | C24H18F4N6O2S |
| Molecular Weight | 530.51 g/mol |
| Exact Mass | 530.11 |
| IUPAC Name | N-[3-[4-fluoro-3-(trifluoromethyl)phenyl]-1,2,4-thiadiazol-5-yl]-4-[(2-propan-2-yloxy-4-pyridinyl)diazenyl]benzamide |
| SMILES | CC(C)Oc1cc(/N=N/c2ccc(C(=O)Nc3nc(-c4ccc(F)c(C(F)(F)F)c4)ns3)cc2)ccn1 |
| InChI | InChI=1S/C24H18F4N6O2S/c1-13(2)36-20-12-17(9-10-29-20)33-32-16-6-3-14(4-7-16)22(35)31-23-30-21(34-37-23)15-5-8-19(25)18(11-15)24(26,27)28/h3-13H,1-2H3,(H,30,31,34,35)/b33-32+ |
| InChIKey | VEQMHOPNAGLBHD-ULIFNZDWSA-N |
| XLogP | 7.21 |
| TPSA | 101.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.51 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|