C34H51NO3 — CID 69226584
[3,5-bis[3-(4-tert-butylphenyl)butyl]-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]methanol (PubChem CID 69226584) has the molecular formula C34H51NO3 and a molecular weight of 521.79 g/mol. Its IUPAC name is [3,5-bis[3-(4-tert-butylphenyl)butyl]-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]methanol.
| Compound Name | [3,5-bis[3-(4-tert-butylphenyl)butyl]-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]methanol |
|---|---|
| PubChem CID | 69226584 |
| Molecular Formula | C34H51NO3 |
| Molecular Weight | 521.79 g/mol |
| Exact Mass | 521.39 |
| IUPAC Name | [3,5-bis[3-(4-tert-butylphenyl)butyl]-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]methanol |
| SMILES | CC(CCC1OCC2(CO)COC(CCC(C)c3ccc(C(C)(C)C)cc3)N12)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C34H51NO3/c1-24(26-11-15-28(16-12-26)32(3,4)5)9-19-30-35-31(38-23-34(35,21-36)22-37-30)20-10-25(2)27-13-17-29(18-14-27)33(6,7)8/h11-18,24-25,30-31,36H,9-10,19-23H2,1-8H3 |
| InChIKey | SGHUXTFXDXWVBW-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.79 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |