C19H24N4O3S — CID 69226913
(9R,10R)-9-hydroxy-10-[[(2R)-4-(2-methoxy-1,3-thiazol-5-yl)butan-2-yl]amino]-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one (PubChem CID 69226913) has the molecular formula C19H24N4O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is (9R,10R)-9-hydroxy-10-[[(2R)-4-(2-methoxy-1,3-thiazol-5-yl)butan-2-yl]amino]-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one.
| Compound Name | (9R,10R)-9-hydroxy-10-[[(2R)-4-(2-methoxy-1,3-thiazol-5-yl)butan-2-yl]amino]-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one |
|---|---|
| PubChem CID | 69226913 |
| Molecular Formula | C19H24N4O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | (9R,10R)-9-hydroxy-10-[[(2R)-4-(2-methoxy-1,3-thiazol-5-yl)butan-2-yl]amino]-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one |
| SMILES | COc1ncc(CC[C@@H](C)N[C@@H]2CCn3c(=O)[nH]c4cccc(c43)[C@H]2O)s1 |
| InChI | InChI=1S/C19H24N4O3S/c1-11(6-7-12-10-20-19(26-2)27-12)21-15-8-9-23-16-13(17(15)24)4-3-5-14(16)22-18(23)25/h3-5,10-11,15,17,21,24H,6-9H2,1-2H3,(H,22,25)/t11-,15-,17-/m1/s1 |
| InChIKey | KHHBSDNOGGIXIS-RGYTYGDFSA-N |
| XLogP | 2.21 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |