C21H33N3O4S — CID 69226951
2-[1-(benzenesulfonyl)piperidin-3-yl]-2-ethyl-N-morpholin-4-ylbutanamide (PubChem CID 69226951) has the molecular formula C21H33N3O4S and a molecular weight of 423.58 g/mol. Its IUPAC name is 2-[1-(benzenesulfonyl)piperidin-3-yl]-2-ethyl-N-morpholin-4-ylbutanamide.
| Compound Name | 2-[1-(benzenesulfonyl)piperidin-3-yl]-2-ethyl-N-morpholin-4-ylbutanamide |
|---|---|
| PubChem CID | 69226951 |
| Molecular Formula | C21H33N3O4S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 2-[1-(benzenesulfonyl)piperidin-3-yl]-2-ethyl-N-morpholin-4-ylbutanamide |
| SMILES | CCC(CC)(C(=O)NN1CCOCC1)C1CCCN(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C21H33N3O4S/c1-3-21(4-2,20(25)22-23-13-15-28-16-14-23)18-9-8-12-24(17-18)29(26,27)19-10-6-5-7-11-19/h5-7,10-11,18H,3-4,8-9,12-17H2,1-2H3,(H,22,25) |
| InChIKey | GCJWBXXMGWZYDN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |