C9H15NO — CID 69227002
2,3,4,5,6,7-hexahydro-1H-isoquinolin-4a-ol (PubChem CID 69227002) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 2,3,4,5,6,7-hexahydro-1H-isoquinolin-4a-ol.
| Compound Name | 2,3,4,5,6,7-hexahydro-1H-isoquinolin-4a-ol |
|---|---|
| PubChem CID | 69227002 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 2,3,4,5,6,7-hexahydro-1H-isoquinolin-4a-ol |
| SMILES | OC12CCCC=C1CNCC2 |
| InChI | InChI=1S/C9H15NO/c11-9-4-2-1-3-8(9)7-10-6-5-9/h3,10-11H,1-2,4-7H2 |
| InChIKey | INOITNQLVZRIBA-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|