C29H42N4O4 — CID 69227077
(2R,4S)-N-butyl-4-hydroxy-4-[(4S)-19-methoxy-2-oxo-3,16,18-triazatricyclo[15.3.1.16,10]docosa-1(21),6,8,10(22),17,19-hexaen-4-yl]-2-methylbutanamide (PubChem CID 69227077) has the molecular formula C29H42N4O4 and a molecular weight of 510.68 g/mol. Its IUPAC name is (2R,4S)-N-butyl-4-hydroxy-4-[(4S)-19-methoxy-2-oxo-3,16,18-triazatricyclo[15.3.1.16,10]docosa-1(21),6,8,10(22),17,19-hexaen-4-yl]-2-methylbutanamide.
| Compound Name | (2R,4S)-N-butyl-4-hydroxy-4-[(4S)-19-methoxy-2-oxo-3,16,18-triazatricyclo[15.3.1.16,10]docosa-1(21),6,8,10(22),17,19-hexaen-4-yl]-2-methylbutanamide |
|---|---|
| PubChem CID | 69227077 |
| Molecular Formula | C29H42N4O4 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.32 |
| IUPAC Name | (2R,4S)-N-butyl-4-hydroxy-4-[(4S)-19-methoxy-2-oxo-3,16,18-triazatricyclo[15.3.1.16,10]docosa-1(21),6,8,10(22),17,19-hexaen-4-yl]-2-methylbutanamide |
| SMILES | CCCCNC(=O)[C@H](C)C[C@H](O)[C@@H]1Cc2cccc(c2)CCCCCNc2cc(cc(OC)n2)C(=O)N1 |
| InChI | InChI=1S/C29H42N4O4/c1-4-5-13-31-28(35)20(2)15-25(34)24-17-22-12-9-11-21(16-22)10-7-6-8-14-30-26-18-23(29(36)32-24)19-27(33-26)37-3/h9,11-12,16,18-20,24-25,34H,4-8,10,13-15,17H2,1-3H3,(H,30,33)(H,31,35)(H,32,36)/t20-,24+,25+/m1/s1 |
| InChIKey | CTQGFWBADSRVGP-YNJKOYDBSA-N |
| XLogP | 3.87 |
| TPSA | 112.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|