About 1-[4-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-ylsulfanyl)methyl]phenyl]ethanone
1-[4-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-ylsulfanyl)methyl]phenyl]ethanone (PubChem CID 69227150) has the molecular formula C19H18O3S
and a molecular weight of 326.42 g/mol. Its IUPAC name is 1-[4-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-ylsulfanyl)methyl]phenyl]ethanone.
Molecular Properties
| Compound Name | 1-[4-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-ylsulfanyl)methyl]phenyl]ethanone |
| PubChem CID | 69227150 |
| Molecular Formula | C19H18O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 1-[4-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-ylsulfanyl)methyl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(C(SC2=COC=CO2)C2=CC=CCC2)cc1 |
| InChI | InChI=1S/C19H18O3S/c1-14(20)15-7-9-17(10-8-15)19(16-5-3-2-4-6-16)23-18-13-21-11-12-22-18/h2-3,5,7-13,19H,4,6H2,1H3 |
| InChIKey | NDGWONHDSOQDPZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-ylsulfanyl)methyl]phenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-ylsulfanyl)methyl]phenyl]ethanone?
The IUPAC name of 1-[4-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-ylsulfanyl)methyl]phenyl]ethanone (CID 69227150) is 1-[4-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-ylsulfanyl)methyl]phenyl]ethanone.
What is the SMILES notation for 1-[4-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-ylsulfanyl)methyl]phenyl]ethanone?
The canonical SMILES for 1-[4-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-ylsulfanyl)methyl]phenyl]ethanone is CC(=O)c1ccc(C(SC2=COC=CO2)C2=CC=CCC2)cc1.
What is the InChIKey of 1-[4-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-ylsulfanyl)methyl]phenyl]ethanone?
The InChIKey is NDGWONHDSOQDPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18O3S/c1-14(20)15-7-9-17(10-8-15)19(16-5-3-2-4-6-16)23-18-13-21-11-12-22-18/h2-3,5,7-13,19H,4,6H2,1H3.
What are the key properties of 1-[4-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-ylsulfanyl)methyl]phenyl]ethanone?
1-[4-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-ylsulfanyl)methyl]phenyl]ethanone has a molecular weight of 326.42 g/mol, XLogP of 5.26, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-ylsulfanyl)methyl]phenyl]ethanone is sourced from PubChem (CID 69227150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).