C28H40N4O3 — CID 69227179
(2R,4S)-N-butyl-4-hydroxy-2-methyl-4-[(4S)-18-methyl-2-oxo-3,15,17-triazatricyclo[14.3.1.16,10]henicosa-1(20),6,8,10(21),16,18-hexaen-4-yl]butanamide (PubChem CID 69227179) has the molecular formula C28H40N4O3 and a molecular weight of 480.65 g/mol. Its IUPAC name is (2R,4S)-N-butyl-4-hydroxy-2-methyl-4-[(4S)-18-methyl-2-oxo-3,15,17-triazatricyclo[14.3.1.16,10]henicosa-1(20),6,8,10(21),16,18-hexaen-4-yl]butanamide.
| Compound Name | (2R,4S)-N-butyl-4-hydroxy-2-methyl-4-[(4S)-18-methyl-2-oxo-3,15,17-triazatricyclo[14.3.1.16,10]henicosa-1(20),6,8,10(21),16,18-hexaen-4-yl]butanamide |
|---|---|
| PubChem CID | 69227179 |
| Molecular Formula | C28H40N4O3 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | (2R,4S)-N-butyl-4-hydroxy-2-methyl-4-[(4S)-18-methyl-2-oxo-3,15,17-triazatricyclo[14.3.1.16,10]henicosa-1(20),6,8,10(21),16,18-hexaen-4-yl]butanamide |
| SMILES | CCCCNC(=O)[C@H](C)C[C@H](O)[C@@H]1Cc2cccc(c2)CCCCNc2cc(cc(C)n2)C(=O)N1 |
| InChI | InChI=1S/C28H40N4O3/c1-4-5-12-30-27(34)19(2)14-25(33)24-17-22-11-8-10-21(16-22)9-6-7-13-29-26-18-23(28(35)32-24)15-20(3)31-26/h8,10-11,15-16,18-19,24-25,33H,4-7,9,12-14,17H2,1-3H3,(H,29,31)(H,30,34)(H,32,35)/t19-,24+,25+/m1/s1 |
| InChIKey | XITUUYICCONKKK-NGXZDTIWSA-N |
| XLogP | 3.78 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|