About 5-(3,4-difluorophenyl)-4-N-phenylpyrimidine-2,4-diamine
5-(3,4-difluorophenyl)-4-N-phenylpyrimidine-2,4-diamine (PubChem CID 69227473) has the molecular formula C16H12F2N4
and a molecular weight of 298.30 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)-4-N-phenylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-(3,4-difluorophenyl)-4-N-phenylpyrimidine-2,4-diamine |
| PubChem CID | 69227473 |
| Molecular Formula | C16H12F2N4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 5-(3,4-difluorophenyl)-4-N-phenylpyrimidine-2,4-diamine |
| SMILES | Nc1ncc(-c2ccc(F)c(F)c2)c(Nc2ccccc2)n1 |
| InChI | InChI=1S/C16H12F2N4/c17-13-7-6-10(8-14(13)18)12-9-20-16(19)22-15(12)21-11-4-2-1-3-5-11/h1-9H,(H3,19,20,21,22) |
| InChIKey | WOCZUGDEMCWAMW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3,4-difluorophenyl)-4-N-phenylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-difluorophenyl)-4-N-phenylpyrimidine-2,4-diamine?
The IUPAC name of 5-(3,4-difluorophenyl)-4-N-phenylpyrimidine-2,4-diamine (CID 69227473) is 5-(3,4-difluorophenyl)-4-N-phenylpyrimidine-2,4-diamine.
What is the SMILES notation for 5-(3,4-difluorophenyl)-4-N-phenylpyrimidine-2,4-diamine?
The canonical SMILES for 5-(3,4-difluorophenyl)-4-N-phenylpyrimidine-2,4-diamine is Nc1ncc(-c2ccc(F)c(F)c2)c(Nc2ccccc2)n1.
What is the InChIKey of 5-(3,4-difluorophenyl)-4-N-phenylpyrimidine-2,4-diamine?
The InChIKey is WOCZUGDEMCWAMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12F2N4/c17-13-7-6-10(8-14(13)18)12-9-20-16(19)22-15(12)21-11-4-2-1-3-5-11/h1-9H,(H3,19,20,21,22).
What are the key properties of 5-(3,4-difluorophenyl)-4-N-phenylpyrimidine-2,4-diamine?
5-(3,4-difluorophenyl)-4-N-phenylpyrimidine-2,4-diamine has a molecular weight of 298.30 g/mol, XLogP of 3.75, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-difluorophenyl)-4-N-phenylpyrimidine-2,4-diamine is sourced from PubChem (CID 69227473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).