C33H49NO2 — CID 69227985
3,5-bis[3-(4-tert-butylphenyl)butyl]-3,5,7,7a-tetrahydro-1H-[1,3]oxazolo[3,4-c][1,3]oxazole (PubChem CID 69227985) has the molecular formula C33H49NO2 and a molecular weight of 491.76 g/mol. Its IUPAC name is 3,5-bis[3-(4-tert-butylphenyl)butyl]-3,5,7,7a-tetrahydro-1H-[1,3]oxazolo[3,4-c][1,3]oxazole.
| Compound Name | 3,5-bis[3-(4-tert-butylphenyl)butyl]-3,5,7,7a-tetrahydro-1H-[1,3]oxazolo[3,4-c][1,3]oxazole |
|---|---|
| PubChem CID | 69227985 |
| Molecular Formula | C33H49NO2 |
| Molecular Weight | 491.76 g/mol |
| Exact Mass | 491.38 |
| IUPAC Name | 3,5-bis[3-(4-tert-butylphenyl)butyl]-3,5,7,7a-tetrahydro-1H-[1,3]oxazolo[3,4-c][1,3]oxazole |
| SMILES | CC(CCC1OCC2COC(CCC(C)c3ccc(C(C)(C)C)cc3)N21)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C33H49NO2/c1-23(25-11-15-27(16-12-25)32(3,4)5)9-19-30-34-29(21-35-30)22-36-31(34)20-10-24(2)26-13-17-28(18-14-26)33(6,7)8/h11-18,23-24,29-31H,9-10,19-22H2,1-8H3 |
| InChIKey | CDEBLFBQUIBCPT-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.76 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |