About 4-benzyl-5-methyl-1,2-dihydropyrazol-3-one
4-benzyl-5-methyl-1,2-dihydropyrazol-3-one (PubChem CID 6922806) has the molecular formula C11H12N2O
and a molecular weight of 188.23 g/mol. Its IUPAC name is 4-benzyl-5-methyl-1,2-dihydropyrazol-3-one.
Molecular Properties
| Compound Name | 4-benzyl-5-methyl-1,2-dihydropyrazol-3-one |
| PubChem CID | 6922806 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 4-benzyl-5-methyl-1,2-dihydropyrazol-3-one |
| SMILES | Cc1[nH][nH]c(=O)c1Cc1ccccc1 |
| InChI | InChI=1S/C11H12N2O/c1-8-10(11(14)13-12-8)7-9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H2,12,13,14) |
| InChIKey | YSHMJUPGPHEDIR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-benzyl-5-methyl-1,2-dihydropyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-5-methyl-1,2-dihydropyrazol-3-one?
The IUPAC name of 4-benzyl-5-methyl-1,2-dihydropyrazol-3-one (CID 6922806) is 4-benzyl-5-methyl-1,2-dihydropyrazol-3-one.
What is the SMILES notation for 4-benzyl-5-methyl-1,2-dihydropyrazol-3-one?
The canonical SMILES for 4-benzyl-5-methyl-1,2-dihydropyrazol-3-one is Cc1[nH][nH]c(=O)c1Cc1ccccc1.
What is the InChIKey of 4-benzyl-5-methyl-1,2-dihydropyrazol-3-one?
The InChIKey is YSHMJUPGPHEDIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O/c1-8-10(11(14)13-12-8)7-9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H2,12,13,14).
What are the key properties of 4-benzyl-5-methyl-1,2-dihydropyrazol-3-one?
4-benzyl-5-methyl-1,2-dihydropyrazol-3-one has a molecular weight of 188.23 g/mol, XLogP of 1.60, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-5-methyl-1,2-dihydropyrazol-3-one is sourced from PubChem (CID 6922806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).